C21H33N2+ — CID 143968524
[4-[(E)-5-(diethylamino)-2-ethenylpent-4-enylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 143968524) has the molecular formula C21H33N2+ and a molecular weight of 313.51 g/mol. Its IUPAC name is [4-[(E)-5-(diethylamino)-2-ethenylpent-4-enylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[(E)-5-(diethylamino)-2-ethenylpent-4-enylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 143968524 |
| Molecular Formula | C21H33N2+ |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | [4-[(E)-5-(diethylamino)-2-ethenylpent-4-enylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | C=CC(C=C1C=CC(=[N+](CC)CC)C=C1)C/C=C/N(CC)CC |
| InChI | InChI=1S/C21H33N2/c1-6-19(12-11-17-22(7-2)8-3)18-20-13-15-21(16-14-20)23(9-4)10-5/h6,11,13-19H,1,7-10,12H2,2-5H3/q+1/b17-11+ |
| InChIKey | NFALJSOAIVSUAM-GZTJUZNOSA-N |
| XLogP | 4.58 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|