About 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide
2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide (PubChem CID 143971627) has the molecular formula C22H15Cl3N2O2S
and a molecular weight of 477.80 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide |
| PubChem CID | 143971627 |
| Molecular Formula | C22H15Cl3N2O2S |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide |
| SMILES | Cc1ccc(S(=O)Nc2cc(Cl)c(Oc3cnc4ccccc4c3)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl3N2O2S/c1-13-6-7-21(17(23)8-13)30(28)27-15-10-18(24)22(19(25)11-15)29-16-9-14-4-2-3-5-20(14)26-12-16/h2-12,27H,1H3 |
| InChIKey | HUMUPERQRHHDBF-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide?
The IUPAC name of 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide (CID 143971627) is 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide.
What is the SMILES notation for 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide?
The canonical SMILES for 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide is Cc1ccc(S(=O)Nc2cc(Cl)c(Oc3cnc4ccccc4c3)c(Cl)c2)c(Cl)c1.
What is the InChIKey of 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide?
The InChIKey is HUMUPERQRHHDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl3N2O2S/c1-13-6-7-21(17(23)8-13)30(28)27-15-10-18(24)22(19(25)11-15)29-16-9-14-4-2-3-5-20(14)26-12-16/h2-12,27H,1H3.
What are the key properties of 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide?
2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide has a molecular weight of 477.80 g/mol, XLogP of 7.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-4-methylbenzenesulfinamide is sourced from PubChem (CID 143971627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).