C22H16Cl4N2O3S — CID 154982761
4,6-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-5-methylcyclohexa-1,3-diene-1-sulfonamide (PubChem CID 154982761) has the molecular formula C22H16Cl4N2O3S and a molecular weight of 530.26 g/mol. Its IUPAC name is 4,6-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-5-methylcyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | 4,6-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-5-methylcyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 154982761 |
| Molecular Formula | C22H16Cl4N2O3S |
| Molecular Weight | 530.26 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | 4,6-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)-5-methylcyclohexa-1,3-diene-1-sulfonamide |
| SMILES | CC1C(Cl)=CC=C(S(=O)(=O)Nc2cc(Cl)c(Oc3cnc4ccccc4c3)c(Cl)c2)C1Cl |
| InChI | InChI=1S/C22H16Cl4N2O3S/c1-12-16(23)6-7-20(21(12)26)32(29,30)28-14-9-17(24)22(18(25)10-14)31-15-8-13-4-2-3-5-19(13)27-11-15/h2-12,21,28H,1H3 |
| InChIKey | GGHUNTQVFNDNTR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.26 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|