C22H18Cl4N2O3S — CID 155171677
(2E,4E)-2,4-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)hepta-2,4-diene-1-sulfonamide (PubChem CID 155171677) has the molecular formula C22H18Cl4N2O3S and a molecular weight of 532.28 g/mol. Its IUPAC name is (2E,4E)-2,4-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)hepta-2,4-diene-1-sulfonamide.
| Compound Name | (2E,4E)-2,4-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)hepta-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 155171677 |
| Molecular Formula | C22H18Cl4N2O3S |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | (2E,4E)-2,4-dichloro-N-(3,5-dichloro-4-quinolin-3-yloxyphenyl)hepta-2,4-diene-1-sulfonamide |
| SMILES | CC/C=C(Cl)\C=C(\Cl)CS(=O)(=O)Nc1cc(Cl)c(Oc2cnc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl4N2O3S/c1-2-5-15(23)9-16(24)13-32(29,30)28-17-10-19(25)22(20(26)11-17)31-18-8-14-6-3-4-7-21(14)27-12-18/h3-12,28H,2,13H2,1H3/b15-5+,16-9+ |
| InChIKey | CFMGAYOEFPIMKS-FPKJVEIBSA-N |
| XLogP | 7.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|