C15H10Cl2N2O3S — CID 164563480
3-[2,6-dichloro-4-(sulfinoamino)phenoxy]quinoline (PubChem CID 164563480) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(sulfinoamino)phenoxy]quinoline.
| Compound Name | 3-[2,6-dichloro-4-(sulfinoamino)phenoxy]quinoline |
|---|---|
| PubChem CID | 164563480 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 3-[2,6-dichloro-4-(sulfinoamino)phenoxy]quinoline |
| SMILES | O=S(O)Nc1cc(Cl)c(Oc2cnc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O3S/c16-12-6-10(19-23(20)21)7-13(17)15(12)22-11-5-9-3-1-2-4-14(9)18-8-11/h1-8,19H,(H,20,21) |
| InChIKey | LBMSOHZASABSFS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|