C7H8Br2O — CID 143978789
(3Z)-4,5-dibromo-2-methylhexa-1,3,5-trien-3-ol (PubChem CID 143978789) has the molecular formula C7H8Br2O and a molecular weight of 267.95 g/mol. Its IUPAC name is (3Z)-4,5-dibromo-2-methylhexa-1,3,5-trien-3-ol.
| Compound Name | (3Z)-4,5-dibromo-2-methylhexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143978789 |
| Molecular Formula | C7H8Br2O |
| Molecular Weight | 267.95 g/mol |
| Exact Mass | 265.89 |
| IUPAC Name | (3Z)-4,5-dibromo-2-methylhexa-1,3,5-trien-3-ol |
| SMILES | C=C(C)/C(O)=C(/Br)C(=C)Br |
| InChI | InChI=1S/C7H8Br2O/c1-4(2)7(10)6(9)5(3)8/h10H,1,3H2,2H3/b7-6- |
| InChIKey | AUHMJCVKLGTYEP-SREVYHEPSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|