C16H18N4S — CID 143981946
3-amino-4-methyl-1H-1,2,4-triazole-5-thione;1-cyclopropylnaphthalene (PubChem CID 143981946) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 3-amino-4-methyl-1H-1,2,4-triazole-5-thione;1-cyclopropylnaphthalene.
| Compound Name | 3-amino-4-methyl-1H-1,2,4-triazole-5-thione;1-cyclopropylnaphthalene |
|---|---|
| PubChem CID | 143981946 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-amino-4-methyl-1H-1,2,4-triazole-5-thione;1-cyclopropylnaphthalene |
| SMILES | Cn1c(N)n[nH]c1=S.c1ccc2c(C3CC3)cccc2c1 |
| InChI | InChI=1S/C13H12.C3H6N4S/c1-2-6-12-10(4-1)5-3-7-13(12)11-8-9-11;1-7-2(4)5-6-3(7)8/h1-7,11H,8-9H2;1H3,(H2,4,5)(H,6,8) |
| InChIKey | KGVXBMPTTPTTNG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|