C27H36N4 — CID 153403451
1-ethyl-4-pyridin-2-ylpiperazine;1-methyl-4-naphthalen-1-ylpiperidine (PubChem CID 153403451) has the molecular formula C27H36N4 and a molecular weight of 416.61 g/mol. Its IUPAC name is 1-ethyl-4-pyridin-2-ylpiperazine;1-methyl-4-naphthalen-1-ylpiperidine.
| Compound Name | 1-ethyl-4-pyridin-2-ylpiperazine;1-methyl-4-naphthalen-1-ylpiperidine |
|---|---|
| PubChem CID | 153403451 |
| Molecular Formula | C27H36N4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-ethyl-4-pyridin-2-ylpiperazine;1-methyl-4-naphthalen-1-ylpiperidine |
| SMILES | CCN1CCN(c2ccccn2)CC1.CN1CCC(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C16H19N.C11H17N3/c1-17-11-9-14(10-12-17)16-8-4-6-13-5-2-3-7-15(13)16;1-2-13-7-9-14(10-8-13)11-5-3-4-6-12-11/h2-8,14H,9-12H2,1H3;3-6H,2,7-10H2,1H3 |
| InChIKey | XRKAPTZSFCPKMP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |