C17H15N3O5 — CID 143984867
[4-[5-[2-(2-hydroxyethoxy)ethoxy]-[1,3]oxazolo[5,4-b]pyridin-2-yl]phenyl] cyanate (PubChem CID 143984867) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is [4-[5-[2-(2-hydroxyethoxy)ethoxy]-[1,3]oxazolo[5,4-b]pyridin-2-yl]phenyl] cyanate.
| Compound Name | [4-[5-[2-(2-hydroxyethoxy)ethoxy]-[1,3]oxazolo[5,4-b]pyridin-2-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 143984867 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [4-[5-[2-(2-hydroxyethoxy)ethoxy]-[1,3]oxazolo[5,4-b]pyridin-2-yl]phenyl] cyanate |
| SMILES | N#COc1ccc(-c2nc3ccc(OCCOCCO)nc3o2)cc1 |
| InChI | InChI=1S/C17H15N3O5/c18-11-24-13-3-1-12(2-4-13)16-19-14-5-6-15(20-17(14)25-16)23-10-9-22-8-7-21/h1-6,21H,7-10H2 |
| InChIKey | BCMVPBOCHBXDEZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|