About ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one
ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one (PubChem CID 143985409) has the molecular formula C19H25NO4S
and a molecular weight of 363.48 g/mol. Its IUPAC name is ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one.
Molecular Properties
| Compound Name | ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one |
| PubChem CID | 143985409 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one |
| SMILES | C=C/C=C(\C=C)Oc1ccccc1S(=O)(=O)N1CCC(=O)CC1.CC |
| InChI | InChI=1S/C17H19NO4S.C2H6/c1-3-7-15(4-2)22-16-8-5-6-9-17(16)23(20,21)18-12-10-14(19)11-13-18;1-2/h3-9H,1-2,10-13H2;1-2H3/b15-7+; |
| InChIKey | HKSXZSCURJWYTJ-HAZZGOGXSA-N |
| XLogP | 3.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one?
The IUPAC name of ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one (CID 143985409) is ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one.
What is the SMILES notation for ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one?
The canonical SMILES for ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one is C=C/C=C(\C=C)Oc1ccccc1S(=O)(=O)N1CCC(=O)CC1.CC.
What is the InChIKey of ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one?
The InChIKey is HKSXZSCURJWYTJ-HAZZGOGXSA-N. The full InChI is InChI=1S/C17H19NO4S.C2H6/c1-3-7-15(4-2)22-16-8-5-6-9-17(16)23(20,21)18-12-10-14(19)11-13-18;1-2/h3-9H,1-2,10-13H2;1-2H3/b15-7+;.
What are the key properties of ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one?
ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one has a molecular weight of 363.48 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one is sourced from PubChem (CID 143985409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).