C19H25NO4S — CID 143985409
ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one (PubChem CID 143985409) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one.
| Compound Name | ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 143985409 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | ethane;1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylpiperidin-4-one |
| SMILES | C=C/C=C(\C=C)Oc1ccccc1S(=O)(=O)N1CCC(=O)CC1.CC |
| InChI | InChI=1S/C17H19NO4S.C2H6/c1-3-7-15(4-2)22-16-8-5-6-9-17(16)23(20,21)18-12-10-14(19)11-13-18;1-2/h3-9H,1-2,10-13H2;1-2H3/b15-7+; |
| InChIKey | HKSXZSCURJWYTJ-HAZZGOGXSA-N |
| XLogP | 3.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|