C24H34ClFN6O4 — CID 143987010
methyl 4-[amino-[(Z)-[7-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-2-ylidene]methyl]amino]butanoate (PubChem CID 143987010) has the molecular formula C24H34ClFN6O4 and a molecular weight of 525.03 g/mol. Its IUPAC name is methyl 4-[amino-[(Z)-[7-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-2-ylidene]methyl]amino]butanoate.
| Compound Name | methyl 4-[amino-[(Z)-[7-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-2-ylidene]methyl]amino]butanoate |
|---|---|
| PubChem CID | 143987010 |
| Molecular Formula | C24H34ClFN6O4 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | methyl 4-[amino-[(Z)-[7-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-5,5,8a-trimethyl-3,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-2-ylidene]methyl]amino]butanoate |
| SMILES | COC(=O)CCCN(N)/C=C1/CN2C(C)(C)CC(NC(=O)C(=O)Nc3ccc(Cl)c(F)c3)CC2(C)N1 |
| InChI | InChI=1S/C24H34ClFN6O4/c1-23(2)11-16(29-22(35)21(34)28-15-7-8-18(25)19(26)10-15)12-24(3)30-17(14-32(23)24)13-31(27)9-5-6-20(33)36-4/h7-8,10,13,16,30H,5-6,9,11-12,14,27H2,1-4H3,(H,28,34)(H,29,35)/b17-13- |
| InChIKey | JFVGPYKSLUSLBR-LGMDPLHJSA-N |
| XLogP | 2.07 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|