C12H14BrN — CID 143987263
(6Z)-2-bromo-N-ethenyl-6-ethylidene-3,4-dimethylcyclohexa-2,4-dien-1-imine (PubChem CID 143987263) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is (6Z)-2-bromo-N-ethenyl-6-ethylidene-3,4-dimethylcyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-2-bromo-N-ethenyl-6-ethylidene-3,4-dimethylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143987263 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | (6Z)-2-bromo-N-ethenyl-6-ethylidene-3,4-dimethylcyclohexa-2,4-dien-1-imine |
| SMILES | C=C/N=C1\C(Br)=C(C)C(C)=C\C1=C\C |
| InChI | InChI=1S/C12H14BrN/c1-5-10-7-8(3)9(4)11(13)12(10)14-6-2/h5-7H,2H2,1,3-4H3/b10-5-,14-12- |
| InChIKey | FDHCNEVJVWEVRP-JKRAQSOCSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|