C30H36N6O5 — CID 143989882
2-ethyl-6-methoxy-3H-isoindol-1-one;5-[5-[(Z)-3-methylimino-4-[1-(2-methylpropyl)pyrazol-4-yl]but-1-enyl]furan-2-yl]imidazolidine-2,4-dione (PubChem CID 143989882) has the molecular formula C30H36N6O5 and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-3H-isoindol-1-one;5-[5-[(Z)-3-methylimino-4-[1-(2-methylpropyl)pyrazol-4-yl]but-1-enyl]furan-2-yl]imidazolidine-2,4-dione.
| Compound Name | 2-ethyl-6-methoxy-3H-isoindol-1-one;5-[5-[(Z)-3-methylimino-4-[1-(2-methylpropyl)pyrazol-4-yl]but-1-enyl]furan-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143989882 |
| Molecular Formula | C30H36N6O5 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-ethyl-6-methoxy-3H-isoindol-1-one;5-[5-[(Z)-3-methylimino-4-[1-(2-methylpropyl)pyrazol-4-yl]but-1-enyl]furan-2-yl]imidazolidine-2,4-dione |
| SMILES | C/N=C(/C=C\c1ccc(C2NC(=O)NC2=O)o1)Cc1cnn(CC(C)C)c1.CCN1Cc2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C19H23N5O3.C11H13NO2/c1-12(2)10-24-11-13(9-21-24)8-14(20-3)4-5-15-6-7-16(27-15)17-18(25)23-19(26)22-17;1-3-12-7-8-4-5-9(14-2)6-10(8)11(12)13/h4-7,9,11-12,17H,8,10H2,1-3H3,(H2,22,23,25,26);4-6H,3,7H2,1-2H3/b5-4-,20-14-; |
| InChIKey | SYYDUQHGSLHNHA-CTMNPPJJSA-N |
| XLogP | 4.01 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|