C10H12FNO2 — CID 143990844
4-(fluoromethyl)-3-[(1Z)-3-hydroxybuta-1,3-dienyl]-1-methyl-2H-pyrrol-5-one (PubChem CID 143990844) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 4-(fluoromethyl)-3-[(1Z)-3-hydroxybuta-1,3-dienyl]-1-methyl-2H-pyrrol-5-one.
| Compound Name | 4-(fluoromethyl)-3-[(1Z)-3-hydroxybuta-1,3-dienyl]-1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 143990844 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-(fluoromethyl)-3-[(1Z)-3-hydroxybuta-1,3-dienyl]-1-methyl-2H-pyrrol-5-one |
| SMILES | C=C(O)/C=C\C1=C(CF)C(=O)N(C)C1 |
| InChI | InChI=1S/C10H12FNO2/c1-7(13)3-4-8-6-12(2)10(14)9(8)5-11/h3-4,13H,1,5-6H2,2H3/b4-3- |
| InChIKey | OSYSFGMVHVCOFM-ARJAWSKDSA-N |
| XLogP | 1.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|