C27H30N6O3 — CID 143990938
6-methoxy-2-methyl-3H-isoindol-1-one;N-[(Z)-4-methyl-4-(methylamino)-6-[6-(1H-pyrazol-4-yl)-3-pyridinyl]hex-2-en-5-yn-3-yl]formamide (PubChem CID 143990938) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;N-[(Z)-4-methyl-4-(methylamino)-6-[6-(1H-pyrazol-4-yl)-3-pyridinyl]hex-2-en-5-yn-3-yl]formamide.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;N-[(Z)-4-methyl-4-(methylamino)-6-[6-(1H-pyrazol-4-yl)-3-pyridinyl]hex-2-en-5-yn-3-yl]formamide |
|---|---|
| PubChem CID | 143990938 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;N-[(Z)-4-methyl-4-(methylamino)-6-[6-(1H-pyrazol-4-yl)-3-pyridinyl]hex-2-en-5-yn-3-yl]formamide |
| SMILES | C/C=C(\NC=O)C(C)(C#Cc1ccc(-c2cn[nH]c2)nc1)NC.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C17H19N5O.C10H11NO2/c1-4-16(20-12-23)17(2,18-3)8-7-13-5-6-15(19-9-13)14-10-21-22-11-14;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h4-6,9-12,18H,1-3H3,(H,20,23)(H,21,22);3-5H,6H2,1-2H3/b16-4-; |
| InChIKey | KMIFCBABIGGJKB-DQEXCLQCSA-N |
| XLogP | 2.73 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|