C13H19NO — CID 143990975
4-ethyl-3-[(1Z)-3-methoxybuta-1,3-dienyl]-1-methyl-5-methylidene-2H-pyrrole (PubChem CID 143990975) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-ethyl-3-[(1Z)-3-methoxybuta-1,3-dienyl]-1-methyl-5-methylidene-2H-pyrrole.
| Compound Name | 4-ethyl-3-[(1Z)-3-methoxybuta-1,3-dienyl]-1-methyl-5-methylidene-2H-pyrrole |
|---|---|
| PubChem CID | 143990975 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-ethyl-3-[(1Z)-3-methoxybuta-1,3-dienyl]-1-methyl-5-methylidene-2H-pyrrole |
| SMILES | C=C(/C=C\C1=C(CC)C(=C)N(C)C1)OC |
| InChI | InChI=1S/C13H19NO/c1-6-13-11(3)14(4)9-12(13)8-7-10(2)15-5/h7-8H,2-3,6,9H2,1,4-5H3/b8-7- |
| InChIKey | VYVHTHQPPVWRPG-FPLPWBNLSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|