C42H81N3 — CID 143992048
2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-2-methylhydrazinyl]-N,N-dimethylethanamine (PubChem CID 143992048) has the molecular formula C42H81N3 and a molecular weight of 628.13 g/mol. Its IUPAC name is 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-2-methylhydrazinyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-2-methylhydrazinyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 143992048 |
| Molecular Formula | C42H81N3 |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.64 |
| IUPAC Name | 2-[2-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-2-methylhydrazinyl]-N,N-dimethylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(C)NCCN(C)C |
| InChI | InChI=1S/C42H81N3/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-42(45(5)43-40-41-44(3)4)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42-43H,6-13,18-19,24-41H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | VCBVBVDDTSOQHG-ZPPAUJSGSA-N |
| XLogP | 12.76 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|