C25H20N2 — CID 143992225
N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine (PubChem CID 143992225) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine.
| Compound Name | N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine |
|---|---|
| PubChem CID | 143992225 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine |
| SMILES | C1=CCC=C(/C=N/c2cccc3cccc(/N=C/c4ccccc4)c23)C=C1 |
| InChI | InChI=1S/C25H20N2/c1-2-5-11-20(10-4-1)18-26-23-16-8-14-22-15-9-17-24(25(22)23)27-19-21-12-6-3-7-13-21/h1-4,6-19H,5H2/b26-18+,27-19+ |
| InChIKey | RGFSBZDEMPFFNW-BFNWXZRRSA-N |
| XLogP | 6.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|