About N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine
N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine (PubChem CID 143992225) has the molecular formula C25H20N2
and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine.
Molecular Properties
| Compound Name | N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine |
| PubChem CID | 143992225 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine |
| SMILES | C1=CCC=C(/C=N/c2cccc3cccc(/N=C/c4ccccc4)c23)C=C1 |
| InChI | InChI=1S/C25H20N2/c1-2-5-11-20(10-4-1)18-26-23-16-8-14-22-15-9-17-24(25(22)23)27-19-21-12-6-3-7-13-21/h1-4,6-19H,5H2/b26-18+,27-19+ |
| InChIKey | RGFSBZDEMPFFNW-BFNWXZRRSA-N |
| XLogP | 6.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine?
The IUPAC name of N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine (CID 143992225) is N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine.
What is the SMILES notation for N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine?
The canonical SMILES for N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine is C1=CCC=C(/C=N/c2cccc3cccc(/N=C/c4ccccc4)c23)C=C1.
What is the InChIKey of N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine?
The InChIKey is RGFSBZDEMPFFNW-BFNWXZRRSA-N. The full InChI is InChI=1S/C25H20N2/c1-2-5-11-20(10-4-1)18-26-23-16-8-14-22-15-9-17-24(25(22)23)27-19-21-12-6-3-7-13-21/h1-4,6-19H,5H2/b26-18+,27-19+.
What are the key properties of N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine?
N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine has a molecular weight of 348.45 g/mol, XLogP of 6.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[8-(benzylideneamino)naphthalen-1-yl]-1-cyclohepta-1,4,6-trien-1-ylmethanimine is sourced from PubChem (CID 143992225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).