C37H38N2O2 — CID 25185727
N-[8'-(benzylideneamino)-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-1-phenylmethanimine (PubChem CID 25185727) has the molecular formula C37H38N2O2 and a molecular weight of 542.72 g/mol. Its IUPAC name is N-[8'-(benzylideneamino)-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-1-phenylmethanimine.
| Compound Name | N-[8'-(benzylideneamino)-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 25185727 |
| Molecular Formula | C37H38N2O2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | N-[8'-(benzylideneamino)-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-1-phenylmethanimine |
| SMILES | Cc1cc(/N=C/c2ccccc2)c2c(c1)C(C)(C)CC1(CC(C)(C)c3cc(C)cc(/N=C/c4ccccc4)c3O1)O2 |
| InChI | InChI=1S/C37H38N2O2/c1-25-17-29-33(31(19-25)38-21-27-13-9-7-10-14-27)40-37(23-35(29,3)4)24-36(5,6)30-18-26(2)20-32(34(30)41-37)39-22-28-15-11-8-12-16-28/h7-22H,23-24H2,1-6H3/b38-21+,39-22+ |
| InChIKey | WZOKFWNXABKIIJ-JTXJZOSOSA-N |
| XLogP | 9.32 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|