C47H42O4P2 — CID 66556665
5-[4,4,4',4',6,6'-hexamethyl-8'-(5-oxobenzo[b]phosphindol-5-yl)-2,2'-spirobi[3H-chromene]-8-yl]benzo[b]phosphindole 5-oxide (PubChem CID 66556665) has the molecular formula C47H42O4P2 and a molecular weight of 732.80 g/mol. Its IUPAC name is 5-[4,4,4',4',6,6'-hexamethyl-8'-(5-oxobenzo[b]phosphindol-5-yl)-2,2'-spirobi[3H-chromene]-8-yl]benzo[b]phosphindole 5-oxide.
| Compound Name | 5-[4,4,4',4',6,6'-hexamethyl-8'-(5-oxobenzo[b]phosphindol-5-yl)-2,2'-spirobi[3H-chromene]-8-yl]benzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 66556665 |
| Molecular Formula | C47H42O4P2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | 5-[4,4,4',4',6,6'-hexamethyl-8'-(5-oxobenzo[b]phosphindol-5-yl)-2,2'-spirobi[3H-chromene]-8-yl]benzo[b]phosphindole 5-oxide |
| SMILES | Cc1cc2c(c(P3(=O)c4ccccc4-c4ccccc43)c1)OC1(CC2(C)C)CC(C)(C)c2cc(C)cc(P3(=O)c4ccccc4-c4ccccc43)c2O1 |
| InChI | InChI=1S/C47H42O4P2/c1-29-23-35-43(41(25-29)52(48)37-19-11-7-15-31(37)32-16-8-12-20-38(32)52)50-47(27-45(35,3)4)28-46(5,6)36-24-30(2)26-42(44(36)51-47)53(49)39-21-13-9-17-33(39)34-18-10-14-22-40(34)53/h7-26H,27-28H2,1-6H3 |
| InChIKey | KQCXGQAVFLBEOQ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|