C35H54O4P2 — CID 66556836
8,8'-bis[di(propan-2-yl)phosphoryl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene] (PubChem CID 66556836) has the molecular formula C35H54O4P2 and a molecular weight of 600.76 g/mol. Its IUPAC name is 8,8'-bis[di(propan-2-yl)phosphoryl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene].
| Compound Name | 8,8'-bis[di(propan-2-yl)phosphoryl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene] |
|---|---|
| PubChem CID | 66556836 |
| Molecular Formula | C35H54O4P2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 8,8'-bis[di(propan-2-yl)phosphoryl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene] |
| SMILES | Cc1cc2c(c(P(=O)(C(C)C)C(C)C)c1)OC1(CC2(C)C)CC(C)(C)c2cc(C)cc(P(=O)(C(C)C)C(C)C)c2O1 |
| InChI | InChI=1S/C35H54O4P2/c1-21(2)40(36,22(3)4)29-17-25(9)15-27-31(29)38-35(19-33(27,11)12)20-34(13,14)28-16-26(10)18-30(32(28)39-35)41(37,23(5)6)24(7)8/h15-18,21-24H,19-20H2,1-14H3 |
| InChIKey | UHTYKCKPQWQDPR-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|