C37H50N2O4 — CID 102288659
(4S)-4-tert-butyl-2-[8'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 102288659) has the molecular formula C37H50N2O4 and a molecular weight of 586.82 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-[8'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-tert-butyl-2-[8'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102288659 |
| Molecular Formula | C37H50N2O4 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | (4S)-4-tert-butyl-2-[8'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4,4,4',4',6,6'-hexamethyl-2,2'-spirobi[3H-chromene]-8-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc(C2=N[C@@H](C(C)(C)C)CO2)c2c(c1)C(C)(C)CC1(CC(C)(C)c3cc(C)cc(C4=N[C@@H](C(C)(C)C)CO4)c3O1)O2 |
| InChI | InChI=1S/C37H50N2O4/c1-21-13-23(31-38-27(17-40-31)33(3,4)5)29-25(15-21)35(9,10)19-37(42-29)20-36(11,12)26-16-22(2)14-24(30(26)43-37)32-39-28(18-41-32)34(6,7)8/h13-16,27-28H,17-20H2,1-12H3/t27-,28-,37?/m1/s1 |
| InChIKey | XMUQLEOYIAEFPO-VERPGQOZSA-N |
| XLogP | 8.20 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |