C34H38F2N4O5 — CID 143992862
2-(4-benzyl-4-methylpiperidin-1-yl)-6,7-dimethoxy-3H-quinazolin-4-one;N-(5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)formamide (PubChem CID 143992862) has the molecular formula C34H38F2N4O5 and a molecular weight of 620.70 g/mol. Its IUPAC name is 2-(4-benzyl-4-methylpiperidin-1-yl)-6,7-dimethoxy-3H-quinazolin-4-one;N-(5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)formamide.
| Compound Name | 2-(4-benzyl-4-methylpiperidin-1-yl)-6,7-dimethoxy-3H-quinazolin-4-one;N-(5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)formamide |
|---|---|
| PubChem CID | 143992862 |
| Molecular Formula | C34H38F2N4O5 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | 2-(4-benzyl-4-methylpiperidin-1-yl)-6,7-dimethoxy-3H-quinazolin-4-one;N-(5,7-difluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)formamide |
| SMILES | COc1cc2nc(N3CCC(C)(Cc4ccccc4)CC3)[nH]c(=O)c2cc1OC.O=CNC1CCc2c(F)cc(F)cc2C1O |
| InChI | InChI=1S/C23H27N3O3.C11H11F2NO2/c1-23(15-16-7-5-4-6-8-16)9-11-26(12-10-23)22-24-18-14-20(29-3)19(28-2)13-17(18)21(27)25-22;12-6-3-8-7(9(13)4-6)1-2-10(11(8)16)14-5-15/h4-8,13-14H,9-12,15H2,1-3H3,(H,24,25,27);3-5,10-11,16H,1-2H2,(H,14,15) |
| InChIKey | FABUEQUDFYLRHL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|