C9H13NS — CID 143996263
(3Z)-2,5-dimethyl-4-(methylideneamino)hexa-1,3,5-triene-3-thiol (PubChem CID 143996263) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (3Z)-2,5-dimethyl-4-(methylideneamino)hexa-1,3,5-triene-3-thiol.
| Compound Name | (3Z)-2,5-dimethyl-4-(methylideneamino)hexa-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 143996263 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (3Z)-2,5-dimethyl-4-(methylideneamino)hexa-1,3,5-triene-3-thiol |
| SMILES | C=N/C(C(=C)C)=C(\S)C(=C)C |
| InChI | InChI=1S/C9H13NS/c1-6(2)8(10-5)9(11)7(3)4/h11H,1,3,5H2,2,4H3/b9-8- |
| InChIKey | HXNLXXQLWJLULU-HJWRWDBZSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|