C10H19N — CID 145312854
N-[(2E)-3,4-dimethylpenta-2,4-dien-2-yl]methanimine;ethane (PubChem CID 145312854) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is N-[(2E)-3,4-dimethylpenta-2,4-dien-2-yl]methanimine;ethane.
| Compound Name | N-[(2E)-3,4-dimethylpenta-2,4-dien-2-yl]methanimine;ethane |
|---|---|
| PubChem CID | 145312854 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N-[(2E)-3,4-dimethylpenta-2,4-dien-2-yl]methanimine;ethane |
| SMILES | C=N/C(C)=C(\C)C(=C)C.CC |
| InChI | InChI=1S/C8H13N.C2H6/c1-6(2)7(3)8(4)9-5;1-2/h1,5H2,2-4H3;1-2H3/b8-7+; |
| InChIKey | LSSFTUPSXVTGBC-USRGLUTNSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|