C15H28N5O2P — CID 143996926
6-[4-(2-diethoxyphosphanylethyl)piperazin-1-yl]-2-methylpyrimidin-4-amine (PubChem CID 143996926) has the molecular formula C15H28N5O2P and a molecular weight of 341.40 g/mol. Its IUPAC name is 6-[4-(2-diethoxyphosphanylethyl)piperazin-1-yl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-[4-(2-diethoxyphosphanylethyl)piperazin-1-yl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143996926 |
| Molecular Formula | C15H28N5O2P |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 6-[4-(2-diethoxyphosphanylethyl)piperazin-1-yl]-2-methylpyrimidin-4-amine |
| SMILES | CCOP(CCN1CCN(c2cc(N)nc(C)n2)CC1)OCC |
| InChI | InChI=1S/C15H28N5O2P/c1-4-21-23(22-5-2)11-10-19-6-8-20(9-7-19)15-12-14(16)17-13(3)18-15/h12H,4-11H2,1-3H3,(H2,16,17,18) |
| InChIKey | SABYLYMNRYAFPS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|