C10H18O5 — CID 143998136
[(E)-oxolan-2-ylidenemethyl] acetate;propane-2,2-diol (PubChem CID 143998136) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(E)-oxolan-2-ylidenemethyl] acetate;propane-2,2-diol.
| Compound Name | [(E)-oxolan-2-ylidenemethyl] acetate;propane-2,2-diol |
|---|---|
| PubChem CID | 143998136 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(E)-oxolan-2-ylidenemethyl] acetate;propane-2,2-diol |
| SMILES | CC(=O)O/C=C1\CCCO1.CC(C)(O)O |
| InChI | InChI=1S/C7H10O3.C3H8O2/c1-6(8)10-5-7-3-2-4-9-7;1-3(2,4)5/h5H,2-4H2,1H3;4-5H,1-2H3/b7-5+; |
| InChIKey | VKJSHIXQPBAXGE-GZOLSCHFSA-N |
| XLogP | 0.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|