C16H12ClN3O — CID 14423221
2-(3-chlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one (PubChem CID 14423221) has the molecular formula C16H12ClN3O and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one.
| Compound Name | 2-(3-chlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
|---|---|
| PubChem CID | 14423221 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-(3-chlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
| SMILES | O=c1c2c(n(-c3cccc(Cl)c3)c3nccnc13)CCC2 |
| InChI | InChI=1S/C16H12ClN3O/c17-10-3-1-4-11(9-10)20-13-6-2-5-12(13)15(21)14-16(20)19-8-7-18-14/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | AVELJFQWBSVDAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |