C14H15NO3 — CID 14423901
(3R,3aR)-3-ethenyl-7-methoxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 14423901) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (3R,3aR)-3-ethenyl-7-methoxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | (3R,3aR)-3-ethenyl-7-methoxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 14423901 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (3R,3aR)-3-ethenyl-7-methoxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | C=C[C@H]1OC(=O)N2c3ccc(OC)cc3CC[C@H]12 |
| InChI | InChI=1S/C14H15NO3/c1-3-13-12-6-4-9-8-10(17-2)5-7-11(9)15(12)14(16)18-13/h3,5,7-8,12-13H,1,4,6H2,2H3/t12-,13-/m1/s1 |
| InChIKey | GWSMRZNKBOTUFD-CHWSQXEVSA-N |
| XLogP | 2.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|