C19H14FN5 — CID 144500782
N-(4-fluoro-3-methylphenyl)-2-pyrazin-2-ylquinazolin-4-amine (PubChem CID 144500782) has the molecular formula C19H14FN5 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2-pyrazin-2-ylquinazolin-4-amine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2-pyrazin-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 144500782 |
| Molecular Formula | C19H14FN5 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2-pyrazin-2-ylquinazolin-4-amine |
| SMILES | Cc1cc(Nc2nc(-c3cnccn3)nc3ccccc23)ccc1F |
| InChI | InChI=1S/C19H14FN5/c1-12-10-13(6-7-15(12)20)23-18-14-4-2-3-5-16(14)24-19(25-18)17-11-21-8-9-22-17/h2-11H,1H3,(H,23,24,25) |
| InChIKey | DVTBFNRMJWPTJP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |