C19H9FI6 — CID 144502349
1-(2,6-diiodo-4-methylphenyl)-4-(4-fluoro-3,5-diiodophenyl)-2,3-diiodobenzene (PubChem CID 144502349) has the molecular formula C19H9FI6 and a molecular weight of 1017.70 g/mol. Its IUPAC name is 1-(2,6-diiodo-4-methylphenyl)-4-(4-fluoro-3,5-diiodophenyl)-2,3-diiodobenzene.
| Compound Name | 1-(2,6-diiodo-4-methylphenyl)-4-(4-fluoro-3,5-diiodophenyl)-2,3-diiodobenzene |
|---|---|
| PubChem CID | 144502349 |
| Molecular Formula | C19H9FI6 |
| Molecular Weight | 1017.70 g/mol |
| Exact Mass | 1017.50 |
| IUPAC Name | 1-(2,6-diiodo-4-methylphenyl)-4-(4-fluoro-3,5-diiodophenyl)-2,3-diiodobenzene |
| SMILES | Cc1cc(I)c(-c2ccc(-c3cc(I)c(F)c(I)c3)c(I)c2I)c(I)c1 |
| InChI | InChI=1S/C19H9FI6/c1-8-4-12(21)16(13(22)5-8)11-3-2-10(18(25)19(11)26)9-6-14(23)17(20)15(24)7-9/h2-7H,1H3 |
| InChIKey | HCSQFYTYGNTBJU-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.70 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|