C15H22ClNO2 — CID 14450371
(4aS,10bR)-7-methoxy-4,10-dimethyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride (PubChem CID 14450371) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is (4aS,10bR)-7-methoxy-4,10-dimethyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride.
| Compound Name | (4aS,10bR)-7-methoxy-4,10-dimethyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 14450371 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (4aS,10bR)-7-methoxy-4,10-dimethyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
| SMILES | COc1ccc(C)c2c1OC[C@@H]1[C@@H]2CCCN1C.Cl |
| InChI | InChI=1S/C15H21NO2.ClH/c1-10-6-7-13(17-3)15-14(10)11-5-4-8-16(2)12(11)9-18-15;/h6-7,11-12H,4-5,8-9H2,1-3H3;1H/t11-,12+;/m0./s1 |
| InChIKey | GFOWBDUDLRUNEO-ZVWHLABXSA-N |
| XLogP | 3.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |