C19H20N2O3 — CID 144504054
1-(1,3-benzodioxol-5-yl)-6-methylimino-6-pyridin-3-ylhexan-1-one (PubChem CID 144504054) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-6-methylimino-6-pyridin-3-ylhexan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-6-methylimino-6-pyridin-3-ylhexan-1-one |
|---|---|
| PubChem CID | 144504054 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-6-methylimino-6-pyridin-3-ylhexan-1-one |
| SMILES | C/N=C(/CCCCC(=O)c1ccc2c(c1)OCO2)c1cccnc1 |
| InChI | InChI=1S/C19H20N2O3/c1-20-16(15-5-4-10-21-12-15)6-2-3-7-17(22)14-8-9-18-19(11-14)24-13-23-18/h4-5,8-12H,2-3,6-7,13H2,1H3/b20-16- |
| InChIKey | KAJOBBLXHUHUMP-SILNSSARSA-N |
| XLogP | 3.67 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|