C11H15N3O2 — CID 144505829
2-(2-ethanimidoyl-5-methoxyanilino)acetamide (PubChem CID 144505829) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(2-ethanimidoyl-5-methoxyanilino)acetamide.
| Compound Name | 2-(2-ethanimidoyl-5-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 144505829 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(2-ethanimidoyl-5-methoxyanilino)acetamide |
| SMILES | [H]/N=C(\C)c1ccc(OC)cc1NCC(N)=O |
| InChI | InChI=1S/C11H15N3O2/c1-7(12)9-4-3-8(16-2)5-10(9)14-6-11(13)15/h3-5,12,14H,6H2,1-2H3,(H2,13,15)/b12-7+ |
| InChIKey | UNFPKZLYKZKZRN-KPKJPENVSA-N |
| XLogP | 0.98 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|