C26H30F2N2O2 — CID 144506006
tert-butyl N-[(Z)-1-(3,5-difluorophenyl)-3-ethenylimino-4-(4-methylphenyl)hex-4-en-2-yl]carbamate (PubChem CID 144506006) has the molecular formula C26H30F2N2O2 and a molecular weight of 440.53 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-(3,5-difluorophenyl)-3-ethenylimino-4-(4-methylphenyl)hex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-(3,5-difluorophenyl)-3-ethenylimino-4-(4-methylphenyl)hex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 144506006 |
| Molecular Formula | C26H30F2N2O2 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl N-[(Z)-1-(3,5-difluorophenyl)-3-ethenylimino-4-(4-methylphenyl)hex-4-en-2-yl]carbamate |
| SMILES | C=C/N=C(C(=C/C)\c1ccc(C)cc1)/C(Cc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H30F2N2O2/c1-7-22(19-11-9-17(3)10-12-19)24(29-8-2)23(30-25(31)32-26(4,5)6)15-18-13-20(27)16-21(28)14-18/h7-14,16,23H,2,15H2,1,3-6H3,(H,30,31)/b22-7-,29-24+ |
| InChIKey | ZJFBWQRZWDJPFP-LRTXVNRYSA-N |
| XLogP | 6.40 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|