C26H28FN2O3P — CID 11225089
tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-(4-fluorophenyl)propan-2-yl]carbamate (PubChem CID 11225089) has the molecular formula C26H28FN2O3P and a molecular weight of 466.49 g/mol. Its IUPAC name is tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-(4-fluorophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-(4-fluorophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 11225089 |
| Molecular Formula | C26H28FN2O3P |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-(4-fluorophenyl)propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)/C(=N\P(=O)(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN2O3P/c1-19(28-25(30)32-26(2,3)4)24(20-15-17-21(27)18-16-20)29-33(31,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-19H,1-4H3,(H,28,30)/b29-24+/t19-/m0/s1 |
| InChIKey | RNXVEUWBLKMPQF-WKKOBIEJSA-N |
| XLogP | 5.46 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|