C18H23F2N3O2 — CID 91237628
tert-butyl N-[(3S,6R)-3-(2,3-difluorophenyl)-7-methanimidoyl-3,4,5,6-tetrahydro-2H-azepin-6-yl]carbamate (PubChem CID 91237628) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-3-(2,3-difluorophenyl)-7-methanimidoyl-3,4,5,6-tetrahydro-2H-azepin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-3-(2,3-difluorophenyl)-7-methanimidoyl-3,4,5,6-tetrahydro-2H-azepin-6-yl]carbamate |
|---|---|
| PubChem CID | 91237628 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl N-[(3S,6R)-3-(2,3-difluorophenyl)-7-methanimidoyl-3,4,5,6-tetrahydro-2H-azepin-6-yl]carbamate |
| SMILES | [H]/N=C/C1=NC[C@H](c2cccc(F)c2F)CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23F2N3O2/c1-18(2,3)25-17(24)23-14-8-7-11(10-22-15(14)9-21)12-5-4-6-13(19)16(12)20/h4-6,9,11,14,21H,7-8,10H2,1-3H3,(H,23,24)/b21-9+/t11-,14-/m1/s1 |
| InChIKey | KWBVAOUAVNSRTR-ZIFZXTHCSA-N |
| XLogP | 3.83 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|