C12H21NOS — CID 144510954
3-cyclopropyl-4,5-diethyl-1,3-thiazol-2-one;ethane (PubChem CID 144510954) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 3-cyclopropyl-4,5-diethyl-1,3-thiazol-2-one;ethane.
| Compound Name | 3-cyclopropyl-4,5-diethyl-1,3-thiazol-2-one;ethane |
|---|---|
| PubChem CID | 144510954 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-cyclopropyl-4,5-diethyl-1,3-thiazol-2-one;ethane |
| SMILES | CC.CCc1sc(=O)n(C2CC2)c1CC |
| InChI | InChI=1S/C10H15NOS.C2H6/c1-3-8-9(4-2)13-10(12)11(8)7-5-6-7;1-2/h7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | SGAICODYEIMZRM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |