C45H64 — CID 144513860
1-butyl-4-[4-(3-tert-butylphenyl)but-1-en-2-yl]-2-methylbenzene;1-butyl-2-methylbenzene;(3E,5Z)-2,3-dimethylhepta-1,3,5-triene (PubChem CID 144513860) has the molecular formula C45H64 and a molecular weight of 605.01 g/mol. Its IUPAC name is 1-butyl-4-[4-(3-tert-butylphenyl)but-1-en-2-yl]-2-methylbenzene;1-butyl-2-methylbenzene;(3E,5Z)-2,3-dimethylhepta-1,3,5-triene.
| Compound Name | 1-butyl-4-[4-(3-tert-butylphenyl)but-1-en-2-yl]-2-methylbenzene;1-butyl-2-methylbenzene;(3E,5Z)-2,3-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144513860 |
| Molecular Formula | C45H64 |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 604.50 |
| IUPAC Name | 1-butyl-4-[4-(3-tert-butylphenyl)but-1-en-2-yl]-2-methylbenzene;1-butyl-2-methylbenzene;(3E,5Z)-2,3-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C/C=C\C.C=C(CCc1cccc(C(C)(C)C)c1)c1ccc(CCCC)c(C)c1.CCCCc1ccccc1C |
| InChI | InChI=1S/C25H34.C11H16.C9H14/c1-7-8-11-22-15-16-23(17-20(22)3)19(2)13-14-21-10-9-12-24(18-21)25(4,5)6;1-3-4-8-11-9-6-5-7-10(11)2;1-5-6-7-9(4)8(2)3/h9-10,12,15-18H,2,7-8,11,13-14H2,1,3-6H3;5-7,9H,3-4,8H2,1-2H3;5-7H,2H2,1,3-4H3/b;;6-5-,9-7+ |
| InChIKey | OAJVMMBJERAEMB-NQHVARNFSA-N |
| XLogP | 13.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|