C41H60N2 — CID 144514373
butane;1-butyl-2-methylbenzene;2-methyl-5-(10-methyl-7-methylideneundeca-1,10-dien-2-yl)-N-[1-(1H-pyrrol-2-yl)ethenyl]aniline (PubChem CID 144514373) has the molecular formula C41H60N2 and a molecular weight of 580.95 g/mol. Its IUPAC name is butane;1-butyl-2-methylbenzene;2-methyl-5-(10-methyl-7-methylideneundeca-1,10-dien-2-yl)-N-[1-(1H-pyrrol-2-yl)ethenyl]aniline.
| Compound Name | butane;1-butyl-2-methylbenzene;2-methyl-5-(10-methyl-7-methylideneundeca-1,10-dien-2-yl)-N-[1-(1H-pyrrol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 144514373 |
| Molecular Formula | C41H60N2 |
| Molecular Weight | 580.95 g/mol |
| Exact Mass | 580.48 |
| IUPAC Name | butane;1-butyl-2-methylbenzene;2-methyl-5-(10-methyl-7-methylideneundeca-1,10-dien-2-yl)-N-[1-(1H-pyrrol-2-yl)ethenyl]aniline |
| SMILES | C=C(C)CCC(=C)CCCCC(=C)c1ccc(C)c(NC(=C)c2ccc[nH]2)c1.CCCC.CCCCc1ccccc1C |
| InChI | InChI=1S/C26H34N2.C11H16.C4H10/c1-19(2)13-14-20(3)10-7-8-11-21(4)24-16-15-22(5)26(18-24)28-23(6)25-12-9-17-27-25;1-3-4-8-11-9-6-5-7-10(11)2;1-3-4-2/h9,12,15-18,27-28H,1,3-4,6-8,10-11,13-14H2,2,5H3;5-7,9H,3-4,8H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | PJLVTTBLILOUGM-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.95 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|