C27H21O4P — CID 144514545
[4-[(2R)-2-methyl-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-diphenylphosphane (PubChem CID 144514545) has the molecular formula C27H21O4P and a molecular weight of 440.44 g/mol. Its IUPAC name is [4-[(2R)-2-methyl-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-diphenylphosphane.
| Compound Name | [4-[(2R)-2-methyl-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 144514545 |
| Molecular Formula | C27H21O4P |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [4-[(2R)-2-methyl-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-diphenylphosphane |
| SMILES | C[C@@H]1Oc2cccc(-c3c(P(c4ccccc4)c4ccccc4)ccc4c3OCO4)c2O1 |
| InChI | InChI=1S/C27H21O4P/c1-18-30-23-14-8-13-21(26(23)31-18)25-24(16-15-22-27(25)29-17-28-22)32(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-16,18H,17H2,1H3/t18-/m1/s1 |
| InChIKey | ZHCIGOKDVIIHRY-GOSISDBHSA-N |
| XLogP | 4.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|