C18H23N3O — CID 144514929
8-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-3-ethyl-2-propan-2-ylisoquinolin-1-one (PubChem CID 144514929) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 8-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-3-ethyl-2-propan-2-ylisoquinolin-1-one.
| Compound Name | 8-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-3-ethyl-2-propan-2-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 144514929 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 8-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-3-ethyl-2-propan-2-ylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(C(/C=C\N)=C/N)c2c(=O)n1C(C)C |
| InChI | InChI=1S/C18H23N3O/c1-4-15-10-13-6-5-7-16(14(11-20)8-9-19)17(13)18(22)21(15)12(2)3/h5-12H,4,19-20H2,1-3H3/b9-8-,14-11+ |
| InChIKey | JQTNPHQLSGXLRT-YDHKZIGXSA-N |
| XLogP | 2.92 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|