C17H29NO2 — CID 144515558
1-[(3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-dien-1-yl]ethanone (PubChem CID 144515558) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-[(3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-dien-1-yl]ethanone.
| Compound Name | 1-[(3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 144515558 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-[(3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-dien-1-yl]ethanone |
| SMILES | COC1/C=C/CCCCCN(C(C)=O)C/C(C)=C\CC1 |
| InChI | InChI=1S/C17H29NO2/c1-15-10-9-12-17(20-3)11-7-5-4-6-8-13-18(14-15)16(2)19/h7,10-11,17H,4-6,8-9,12-14H2,1-3H3/b11-7+,15-10- |
| InChIKey | NLTYIGLJDXQGRY-OVJOMLMPSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|