C18H31NO2 — CID 144515515
(7E,9R,11S,12Z)-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 144515515) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (7E,9R,11S,12Z)-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,9R,11S,12Z)-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 144515515 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (7E,9R,11S,12Z)-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | CCN1C/C(C)=C\[C@@H](C)C[C@@H](OC)/C=C/CCCCC1=O |
| InChI | InChI=1S/C18H31NO2/c1-5-19-14-16(3)12-15(2)13-17(21-4)10-8-6-7-9-11-18(19)20/h8,10,12,15,17H,5-7,9,11,13-14H2,1-4H3/b10-8+,16-12-/t15-,17+/m1/s1 |
| InChIKey | TZOGGCGXNWKBHV-YRKNDZJYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|