C12H19F3N2 — CID 144518336
2-N-ethyl-1,1,1-trifluoro-3-N-methylidenepropane-2,3-diimine;(3E)-3-methylpenta-1,3-diene (PubChem CID 144518336) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-N-ethyl-1,1,1-trifluoro-3-N-methylidenepropane-2,3-diimine;(3E)-3-methylpenta-1,3-diene.
| Compound Name | 2-N-ethyl-1,1,1-trifluoro-3-N-methylidenepropane-2,3-diimine;(3E)-3-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 144518336 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-N-ethyl-1,1,1-trifluoro-3-N-methylidenepropane-2,3-diimine;(3E)-3-methylpenta-1,3-diene |
| SMILES | C=C/C(C)=C/C.C=NC/C(=N\CC)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2.C6H10/c1-3-11-5(4-10-2)6(7,8)9;1-4-6(3)5-2/h2-4H2,1H3;4-5H,1H2,2-3H3/b11-5+;6-5+ |
| InChIKey | CWANQBBLASHJRS-ULCSBCSESA-N |
| XLogP | 3.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|