C17H16F2N6 — CID 144519989
4-N-[(2,5-difluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-3-yl)pyridine-2,4-diamine (PubChem CID 144519989) has the molecular formula C17H16F2N6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-N-[(2,5-difluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-3-yl)pyridine-2,4-diamine.
| Compound Name | 4-N-[(2,5-difluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-3-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 144519989 |
| Molecular Formula | C17H16F2N6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-N-[(2,5-difluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-3-yl)pyridine-2,4-diamine |
| SMILES | [H]/N=C/c1cnc(Nc2ccn(C)n2)cc1NCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H16F2N6/c1-25-5-4-16(24-25)23-17-7-15(12(8-20)10-22-17)21-9-11-6-13(18)2-3-14(11)19/h2-8,10,20H,9H2,1H3,(H2,21,22,23,24)/b20-8+ |
| InChIKey | MJWJBVQWMNHOOG-DNTJNYDQSA-N |
| XLogP | 3.45 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|