C18H16FN5 — CID 144519992
4-N-[(2-fluorophenyl)methyl]-5-methanimidoyl-2-N-pyridin-2-ylpyridine-2,4-diamine (PubChem CID 144519992) has the molecular formula C18H16FN5 and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]-5-methanimidoyl-2-N-pyridin-2-ylpyridine-2,4-diamine.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]-5-methanimidoyl-2-N-pyridin-2-ylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 144519992 |
| Molecular Formula | C18H16FN5 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]-5-methanimidoyl-2-N-pyridin-2-ylpyridine-2,4-diamine |
| SMILES | [H]/N=C/c1cnc(Nc2ccccn2)cc1NCc1ccccc1F |
| InChI | InChI=1S/C18H16FN5/c19-15-6-2-1-5-13(15)11-22-16-9-18(23-12-14(16)10-20)24-17-7-3-4-8-21-17/h1-10,12,20H,11H2,(H2,21,22,23,24)/b20-10+ |
| InChIKey | DIDQCFCVDCCSSB-KEBDBYFISA-N |
| XLogP | 3.97 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|