About ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine
ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 144521528) has the molecular formula C11H20F3N
and a molecular weight of 223.28 g/mol. Its IUPAC name is ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine |
| PubChem CID | 144521528 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | CC.CC.CC1C=CC=C(C(F)(F)F)N1 |
| InChI | InChI=1S/C7H8F3N.2C2H6/c1-5-3-2-4-6(11-5)7(8,9)10;2*1-2/h2-5,11H,1H3;2*1-2H3 |
| InChIKey | ALMCOZKKOQVBCO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine (CID 144521528) is ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine is CC.CC.CC1C=CC=C(C(F)(F)F)N1.
What is the InChIKey of ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is ALMCOZKKOQVBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N.2C2H6/c1-5-3-2-4-6(11-5)7(8,9)10;2*1-2/h2-5,11H,1H3;2*1-2H3.
What are the key properties of ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine?
ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 223.28 g/mol, XLogP of 4.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-6-(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 144521528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).