C26H35N3OS — CID 144523073
N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-1-(quinolin-8-ylsulfanylamino)cyclobutane-1-carboxamide (PubChem CID 144523073) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-1-(quinolin-8-ylsulfanylamino)cyclobutane-1-carboxamide.
| Compound Name | N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-1-(quinolin-8-ylsulfanylamino)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 144523073 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-1-(quinolin-8-ylsulfanylamino)cyclobutane-1-carboxamide |
| SMILES | CCC1CC2CC(C)CC(C2)C1NC(=O)C1(NSc2cccc3cccnc23)CCC1 |
| InChI | InChI=1S/C26H35N3OS/c1-3-19-15-18-13-17(2)14-21(16-18)23(19)28-25(30)26(10-6-11-26)29-31-22-9-4-7-20-8-5-12-27-24(20)22/h4-5,7-9,12,17-19,21,23,29H,3,6,10-11,13-16H2,1-2H3,(H,28,30) |
| InChIKey | VKOMGOODZSINOR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|