C12H23N — CID 144523747
(E)-4-ethyl-2,5,6-trimethylhept-4-en-3-imine (PubChem CID 144523747) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-4-ethyl-2,5,6-trimethylhept-4-en-3-imine.
| Compound Name | (E)-4-ethyl-2,5,6-trimethylhept-4-en-3-imine |
|---|---|
| PubChem CID | 144523747 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-4-ethyl-2,5,6-trimethylhept-4-en-3-imine |
| SMILES | [H]/N=C(C(/CC)=C(\C)C(C)C)\C(C)C |
| InChI | InChI=1S/C12H23N/c1-7-11(10(6)8(2)3)12(13)9(4)5/h8-9,13H,7H2,1-6H3/b11-10+,13-12+ |
| InChIKey | WRNAQOYOIYHTRS-AQASXUMVSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|